product Name |
Phenylpyruvic acid, sodium salt monohydrate |
Synonyms |
Sodium phenylpyruvate; Phenylpyruvic Acid; 2-Keto-phenylbutyric acid sodium salt Sodium Phenylpyruvate
; sodium 2-oxo-3-phenylpropanoate; sodium 2-oxo-3-phenylpropanoate hydrate |
Molecular Formula |
C9H9NaO4 |
Molecular Weight |
204.1551 |
InChI |
InChI=1/C9H8O3.Na.H2O/c10-8(9(11)12)6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H,11,12);;1H2/q;+1;/p-1 |
CAS Registry Number |
114-76-1 |
EINECS |
204-053-2 |
Molecular Structure |
|
Boiling point |
299.1°C at 760 mmHg |
Flash point |
148.9°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|