product Name |
6-morpholinonicotinic acid |
Synonyms |
6-morpholinopyridine-3-carboxylic acid |
Molecular Formula |
C10H12N2O3 |
Molecular Weight |
208.2139 |
InChI |
InChI=1/C10H12N2O3/c13-10(14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14) |
CAS Registry Number |
120800-52-4 |
Molecular Structure |
|
Density |
1.314g/cm3 |
Melting point |
261℃ |
Boiling point |
446.074°C at 760 mmHg |
Refractive index |
1.585 |
Flash point |
223.578°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|