Ονομασία του προϊόντος |
4-n-Pentylbenzeneboronic acid |
Συνώνυμα |
4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
MF |
C11H17BO2 |
Μοριακό βάρος |
192.0625 |
InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
CAS ΟΧΙ |
121219-12-3 |
Μοριακή δομή |
|
Πυκνότητα |
1.01g/cm3 |
Σημείο βρασμού |
328°C at 760 mmHg |
Δείκτης διάθλασης |
1.509 |
Σημείο ανάφλεξης |
152.2°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|