نام محصول |
2,3,4,6-Tetrafluorobenzoyl chloride |
مترادف |
-2,3,4,6-TETRAFLUOROBENZOYL CHLORIDE; Benzoyl chloride, 2,3,4,6-tetrafluoro- (9CI) |
میدان مغناطیسی |
C7HClF4O |
وزن مولکولی |
212.5289 |
InChI |
InChI=1/C7HClF4O/c8-7(13)4-2(9)1-3(10)5(11)6(4)12/h1H |
شماره سیایاس |
123016-51-3 |
ساختار مولکولی |
|
تراکم |
1.601g/cm3 |
نقطه غلیان |
158.3°C at 760 mmHg |
ضریب شکست |
1.461 |
نقطه اشتعال |
49.5°C |
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|