اسم المنتج |
Potassium hydrogen oxalate |
الاسم المستعار |
Potassium acid oxalate; Potassium binoxalate; Essential salt of lemon; Ethanedioic acid, monopotassium salt; HSDB 671; Kleesalz; Kleesalz [German]; Monopotassium oxalate; Oxalic acid, monopotassium salt; Potassium oxalate (KHC2O4); Potassium quadroxalate; Potassium salt of sorrel; Sal Acetosella; Salt of sorrel; Sorrel salt; Ethanedioic acid, potassium salt (1:1); dipotassium ethanedioate; Potassium Hydrogendi Oxalate |
الصيغة الجزيئية |
C2K2O4 |
الوزن الجزيئي الغرامي |
166.2156 |
InChI |
InChI=1/C2H2O4.2K/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
إستراتيجية المساعدة القطرية |
127-95-7 |
المفوضية الأوروبية رقم |
204-873-0 |
بنية جزيئية |
|
نقطة الغليان |
365.1°C at 760 mmHg |
نقطة الوميض |
188.8°C |
|