product Name |
ethyl 2-amino-4-propylpyrimidine-5-carboxylate |
Molecular Formula |
C10H15N3O2 |
Molecular Weight |
209.245 |
InChI |
InChI=1/C10H15N3O2/c1-3-5-8-7(9(14)15-4-2)6-12-10(11)13-8/h6H,3-5H2,1-2H3,(H2,11,12,13) |
CAS Registry Number |
127957-83-9 |
Molecular Structure |
|
Density |
1.15g/cm3 |
Melting point |
127℃ |
Boiling point |
396.9°C at 760 mmHg |
Refractive index |
1.542 |
Flash point |
193.8°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|