Ürün Adı |
2-(8-Chloro-1-naphthylthio)acetic acid |
Eş anlamlı |
2-[(8-Chloro-1-naphthyl)thio]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetic acid; [(8-chloronaphthalen-1-yl)sulfanyl]acetate |
Moleküler Formülü |
C12H8ClO2S |
Molekül Ağırlığı |
251.7093 |
InChI |
InChI=1/C12H9ClO2S/c13-9-5-1-3-8-4-2-6-10(12(8)9)16-7-11(14)15/h1-6H,7H2,(H,14,15)/p-1 |
CAS kayıt numarası |
129-94-2 |
EINECS |
204-971-3 |
Moleküler Yapısı |
|
Ergime noktası |
155-157℃ |
Kaynama noktası |
450.1°C at 760 mmHg |
Alevlenme noktası |
226°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|