نام محصول |
3-(1-Naphthyl)acrylic acid |
مترادف |
(2E)-3-(naphthalen-1-yl)prop-2-enoic acid; (2E)-3-naphthalen-1-ylprop-2-enal; (2E)-3-naphthalen-1-ylprop-2-enoate; 1-Naphthylacrylic acid |
میدان مغناطیسی |
C13H9O2 |
وزن مولکولی |
197.2099 |
InChI |
InChI=1/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/p-1/b9-8+ |
شماره سیایاس |
13026-12-5 |
تعداد کمیسیون اروپایی |
235-887-5 |
ساختار مولکولی |
|
نقطه غلیان |
393.1°C at 760 mmHg |
نقطه اشتعال |
290.7°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|