상품명칭 |
DL-Anabasine |
별명 |
2-Pyridin-3-ylpiperidine; Neonicotine~2-(3-Pyridyl)piperidine; 3-piperidin-2-ylpyridine; 3-(piperidin-2-yl)pyridine hydrochloride (1:1); 3-(2-piperidyl)pyridine; 3-(piperidin-2-yl)pyridine |
분자식 |
C10H14N2 |
분자량 |
162.2316 |
InChI |
InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
cas번호 |
13078-04-1 |
EC번호 |
207-791-3 |
분자 구조 |
|
밀도 |
1.014g/cm3 |
녹는 점 |
9℃ |
비등점 |
271°C at 760 mmHg |
굴절 지수 |
1.524 |
인화점 |
93.3°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|