Naam product |
1-(4-Chlorophenyl)-piperazine monohydrochloride |
Synoniemen |
1-(4-Chlorophenyl)piperazine monohydrochloride; 1-(4-chlorophenyl)piperazine hydrochloride |
MF |
C10H14Cl2N2 |
Molecuulgewicht |
233.1376 |
InChI |
InChI=1/C10H13ClN2.ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H |
CAS-nummer |
13078-12-1 |
EINECS |
254-165-0 |
Moleculaire Structuur |
|
Kookpunt |
336.3°C at 760 mmHg |
Vlampunt |
157.2°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|