نام محصول |
N,N'-o-Phenylenedimaleimide |
مترادف |
1,2-Phenylene-bis-maleimide; 1,1'-benzene-1,2-diylbis(1H-pyrrole-2,5-dione) |
میدان مغناطیسی |
C14H8N2O4 |
وزن مولکولی |
268.2243 |
InChI |
InChI=1/C14H8N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10(9)16-13(19)7-8-14(16)20/h1-8H |
شماره سیایاس |
13118-04-2 |
تعداد کمیسیون اروپایی |
236-046-5 |
ساختار مولکولی |
|
تراکم |
1.567g/cm3 |
نقطه ذوب |
245-248℃ |
نقطه غلیان |
459.7°C at 760 mmHg |
ضریب شکست |
1.703 |
نقطه اشتعال |
223.7°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|