termék neve |
4-fluoro-2-iodotoluene |
Szinonimák |
4-Fluoro-2-iodo-1-methylbenzene |
MF |
C7H6FI |
Molekulatömeg |
236.0254 |
InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
CAS-szám |
13194-67-7 |
EINECS |
236-153-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.788g/cm3 |
Forráspont |
205.1°C at 760 mmHg |
Törésmutató |
1.58 |
Gyulladáspont |
81°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|