اسم المنتج |
hydroxyoctadecanoic acid, monoester with glycerol |
الاسم المستعار |
Glyceryl hydroxystearate; Hydroxystearic acid, monoester with glycerol; Stearic acid, hydroxy-, monoester with glycerol; Hydroxyoctadecanoic acid, monoester with glycerol; Octadecanoic acid, hydroxy-, monoester with 1,2,3-propanetriol; 1,3-dihydroxypropan-2-yl 2-hydroxyoctadecanoate |
الصيغة الجزيئية |
C21H42O5 |
الوزن الجزيئي الغرامي |
374.5552 |
InChI |
InChI=1/C21H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)21(25)26-19(17-22)18-23/h19-20,22-24H,2-18H2,1H3 |
إستراتيجية المساعدة القطرية |
1323-42-8 |
المفوضية الأوروبية رقم |
215-355-9 |
بنية جزيئية |
|
كثافة |
1.007g/cm3 |
نقطة الغليان |
520.5°C at 760 mmHg |
معامل الإنكسار |
1.479 |
نقطة الوميض |
168.9°C |
|