상품명칭 |
Phenyl 4-aminosalicylate |
별명 |
4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate;
; phenyl 4-amino-2-hydroxybenzoate |
분자식 |
C13H11NO3 |
분자량 |
229.2313 |
InChI |
InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
cas번호 |
133-11-9 |
EC번호 |
205-092-8 |
분자 구조 |
|
밀도 |
1.32g/cm3 |
녹는 점 |
147-152℃ |
비등점 |
406.4°C at 760 mmHg |
굴절 지수 |
1.659 |
인화점 |
199.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|