Nome del prodotto |
Reaction mass of 2,2'-methylenediphenol and 4,4'-methylenediphenol and o-[(4-hydroxyphenyl)methyl]phenol |
Sinonimi |
Bis(hydroxyphenyl) methane; HYDROXYPHENYLMETHYLPHENOL; methylenebis-Phenol; Dihydroxydiphenylmethane, isomer mixture; 2,2'-methanediyldiphenol |
Formula molecolare |
C13H12O2 |
Peso Molecolare |
200.2332 |
InChI |
InChI=1/C13H12O2/c14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-8,14-15H,9H2 |
Numero CAS |
1333-16-0 |
EINECS |
219-578-2 |
Struttura molecolare |
|
Densità |
1.208g/cm3 |
Punto di ebollizione |
362.5°C at 760 mmHg |
Indice di rifrazione |
1.635 |
Punto d'infiammabilità |
177.1°C |
|