product Name |
sorbitan monolaurate |
Synonyms |
span (R) 20 hlb-value 8.6; span(R) 20 solution; Sorbitan Monolaurate (Span-20); sorbitan laurate; Span #20 (Sorbitan monolaurate); Span(rg 20; Span?20; Span?20 solution; Span-20; Emulsifier S-20; [2-[(2R,3S,4R)-3,4-dihydroxytetrahydrofuran-2-yl]-2-hydroxy-ethyl] dodecanoate; 3,6-anhydro-1-O-dodecanoylhexitol; 1,4-anhydro-6-O-dodecanoyl-D-glucitol; 1,4-Anhydro-D-glucitol, 6-dodecanoate |
Molecular Formula |
C18H34O6 |
Molecular Weight |
346.459 |
InChI |
InChI=1/C18H34O6/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-13-15(20)18-17(22)14(19)12-24-18/h14-15,17-20,22H,2-13H2,1H3/t14-,15+,17+,18?/m0/s1 |
CAS Registry Number |
1338-39-2 |
EINECS |
215-663-3 |
Molecular Structure |
|
Density |
1.123g/cm3 |
Boiling point |
516.1°C at 760 mmHg |
Refractive index |
1.504 |
Flash point |
176.9°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|