Nome del prodotto |
2-Benzoylthiophene |
Sinonimi |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
Formula molecolare |
C11H8OS |
Peso Molecolare |
188.2456 |
InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
Numero CAS |
135-00-2 |
EINECS |
205-169-6 |
Struttura molecolare |
|
Densità |
1.198g/cm3 |
Punto di ebollizione |
300°C at 760 mmHg |
Indice di rifrazione |
1.609 |
Punto d'infiammabilità |
139.7°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|