Produkt-Name |
3,5-difluoropropiophenone |
Synonyme |
1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
Molekulare Formel |
C9H8F2O |
Molecular Weight |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
CAS Registry Number |
135306-45-5 |
Molecular Structure |
|
Dichte |
1.179g/cm3 |
Schmelzpunkt |
25-27℃ |
Siedepunkt |
191.5°C at 760 mmHg |
Brechungsindex |
1.472 |
Flammpunkt |
70.6°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|