product Name |
4-Bromo-3-chlorophenol |
Molecular Formula |
C6H4BrClO |
Molecular Weight |
207.4524 |
InChI |
InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
CAS Registry Number |
13631-21-5 |
Molecular Structure |
|
Density |
1.788g/cm3 |
Boiling point |
267.5°C at 760 mmHg |
Refractive index |
1.619 |
Flash point |
115.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|