نام محصول |
1,2,3-propanetriyl tris(12-hydroxyoctadecanoate) |
مترادف |
Glyceryl tris(12-hydroxystearate); 12-Hydroxyoctadecanoic acid, glyceryl ester; 12-Hydroxyoctadecanoic acid, triester with glycerol; 12-Hydroxystearic acid triglyceride; AI3-19740; Glycerol tris(12-hydroxystearate); NSC 2389; Octadecanoic acid, 12-hydroxy-, triester with glycerol; Thixin R; UNII-06YD7896S3; 1,2,3-Propanetriyl tris(12-hydroxyoctadecanoate); Octadecanoic acid, 12-hydroxy-, 1,1',1''-(1,2,3-propanetriyl) ester; propane-1,2,3-triyl tris(12-hydroxyoctadecanoatato) |
میدان مغناطیسی |
C57H110O9 |
وزن مولکولی |
939.4779 |
InChI |
InChI=1/C57H110O9/c1-4-7-10-31-40-51(58)43-34-25-19-13-16-22-28-37-46-55(61)64-49-54(66-57(63)48-39-30-24-18-15-21-27-36-45-53(60)42-33-12-9-6-3)50-65-56(62)47-38-29-23-17-14-20-26-35-44-52(59)41-32-11-8-5-2/h51-54,58-60H,4-50H2,1-3H3 |
شماره سیایاس |
139-44-6 |
تعداد کمیسیون اروپایی |
205-364-6 |
ساختار مولکولی |
|
تراکم |
0.964g/cm3 |
نقطه غلیان |
872.4°C at 760 mmHg |
ضریب شکست |
1.478 |
نقطه اشتعال |
220.1°C |
|