product Name |
3,5-Dibromo-4-methylphenol |
Synonyms |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
Molecular Formula |
C7H6Br2O |
Molecular Weight |
265.9299 |
InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
CAS Registry Number |
13979-81-2 |
EINECS |
237-763-6 |
Molecular Structure |
|
Density |
1.948g/cm3 |
Boiling point |
293.1°C at 760 mmHg |
Refractive index |
1.626 |
Flash point |
131.1°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|