اسم المنتج |
4-(difluoromethoxy)phenacyl bromide |
الاسم المستعار |
2-Bromo-1-[4-(difluoromethoxy)phenyl]ethan-1-one; 2-bromo-1-[4-(difluoromethoxy)phenyl]ethanone |
الصيغة الجزيئية |
C9H7BrF2O2 |
الوزن الجزيئي الغرامي |
265.0515 |
InChI |
InChI=1/C9H7BrF2O2/c10-5-8(13)6-1-3-7(4-2-6)14-9(11)12/h1-4,9H,5H2 |
إستراتيجية المساعدة القطرية |
141134-24-9 |
بنية جزيئية |
|
كثافة |
1.564g/cm3 |
درجة الإنصهار |
66-68℃ |
نقطة الغليان |
301.9°C at 760 mmHg |
معامل الإنكسار |
1.513 |
نقطة الوميض |
136.4°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|