اسم المنتج |
2,3,4-trifluorobenzyl alcohol |
الاسم المستعار |
1,2,3-trifluoro-4-methoxybenzene; (2,3,4-trifluorophenyl)methanol |
الصيغة الجزيئية |
C7H5F3O |
الوزن الجزيئي الغرامي |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
إستراتيجية المساعدة القطرية |
144284-24-2 |
بنية جزيئية |
|
كثافة |
1.398g/cm3 |
نقطة الغليان |
195.5°C at 760 mmHg |
معامل الإنكسار |
1.476 |
نقطة الوميض |
84.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|