상품명칭 |
4-Nitrocinnamyl alcohol |
별명 |
2-Propen-1-ol, 3-(4-nitrophenyl)-; 2-Propen-1-ol, 3-(p-nitrophenyl)-; 3-(4-nitrophenyl)prop-2-en-1-ol; (2E)-3-(4-nitrophenyl)prop-2-en-1-ol |
분자식 |
C9H9NO3 |
분자량 |
179.1727 |
InChI |
InChI=1/C9H9NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-6,11H,7H2/b2-1+ |
cas번호 |
1504-63-8 |
분자 구조 |
|
밀도 |
1.282g/cm3 |
녹는 점 |
127-128℃ |
비등점 |
325.3°C at 760 mmHg |
굴절 지수 |
1.637 |
인화점 |
144.1°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|