Nome del prodotto |
2-Bromo-3,4,5,6-tetrafluorobenzoylchloride |
Sinonimi |
2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride |
Formula molecolare |
C7BrClF4O |
Peso Molecolare |
291.4249 |
InChI |
InChI=1/C7BrClF4O/c8-2-1(7(9)14)3(10)5(12)6(13)4(2)11 |
Numero CAS |
151096-42-3 |
Struttura molecolare |
|
Densità |
1.957g/cm3 |
Punto di ebollizione |
216.6°C at 760 mmHg |
Indice di rifrazione |
1.505 |
Punto d'infiammabilità |
84.8°C |
Codici di Rischio |
R34:Causes burns.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|