termék neve |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
Szinonimák |
Ethyl-4,4,4-trifluoro-3-(trifluoromethyl)-crotonate; 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ethyl ester; 1-ethynyl-3,5-difluorobenzene |
MF |
C8H4F2 |
Molekulatömeg |
138.1142 |
InChI |
InChI=1/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
CAS-szám |
1513-60-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.17g/cm3 |
Forráspont |
147.1°C at 760 mmHg |
Törésmutató |
1.492 |
Gyulladáspont |
32°C |
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|