상품명칭 |
2,3,6-trifluorobenzyl bromide |
별명 |
alpha-Bromo-2,3,6-trifluorotoluene; 2-(bromomethyl)-1,3,4-trifluorobenzene; 1-(bromomethyl)-2-fluoro-3-methylbenzene |
분자식 |
C8H8BrF |
분자량 |
203.0515 |
InChI |
InChI=1/C8H8BrF/c1-6-3-2-4-7(5-9)8(6)10/h2-4H,5H2,1H3 |
cas번호 |
151412-02-1 |
분자 구조 |
|
밀도 |
1.456g/cm3 |
녹는 점 |
114-46℃ |
비등점 |
211.6°C at 760 mmHg |
굴절 지수 |
1.539 |
인화점 |
84.5°C |
리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|