상품명칭 |
2,4-Hexadienyl acetate |
별명 |
trans,trans-2,4-Hexadienyl acetate; hexa-2,4-dien-1-yl acetate; (2E,4E)-hexa-2,4-dien-1-yl acetate |
분자식 |
C8H12O2 |
분자량 |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
cas번호 |
1516-17-2 |
EC번호 |
216-163-8 |
분자 구조 |
|
밀도 |
0.926g/cm3 |
비등점 |
186.5°C at 760 mmHg |
굴절 지수 |
1.454 |
인화점 |
79.6°C |
리스크 규칙 |
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|