उत्पाद का नाम |
Diphenyl tere-phthalate |
समानार्थी |
Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
आणविक फार्मूला |
C20H14O4 |
आण्विक वजन |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
कैस रजिस्टी संख्या |
1539-04-4 |
EINECS |
216-264-7 |
आणविक संरचना |
|
घनत्व |
1.242g/cm3 |
गलनांक |
197-199℃ |
उबलने का समय |
496.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.615 |
फ्लैश प्वाइंट |
255°C |
सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|