Nama produk |
4-(difluoromethoxy)nitrobenzene |
Sinonim |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
MF |
C7H5F2NO2 |
Berat Molekul |
173.1169 |
InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
CAS NO |
1544-86-1 |
Struktur Molekul |
|
Kepadatan |
1.339g/cm3 |
Titik lebur |
33-110℃ |
Titik didih |
240.7°C at 760 mmHg |
Indeks bias |
1.5 |
Titik nyala |
111.9°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|