Nome do produto |
cyclohexyl butyrate |
Sinônimos |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
Fórmula molecular |
C10H18O2 |
Peso Molecular |
170.2487 |
InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
CAS Registry Number |
1551-44-6 |
EINECS |
216-290-9 |
Estrutura Molecular |
|
Densidade |
0.94g/cm3 |
Ponto de ebulição |
214.9°C at 760 mmHg |
índice de refração |
1.449 |
O ponto de inflamação |
78°C |
Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|