Ονομασία του προϊόντος |
3-(2-Thienyl)acrylic acid |
Συνώνυμα |
Thiophene-2-acrylic acid; 3-(2-Thiophenyl)propenoic acid; (2E)-3-thiophen-2-ylprop-2-enoate |
MF |
C7H5O2S |
Μοριακό βάρος |
153.1789 |
InChI |
InChI=1/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/p-1/b4-3+ |
CAS ΟΧΙ |
15690-25-2 |
Μοριακή δομή |
|
Σημείο τήξης |
145-148℃ |
Σημείο βρασμού |
298.9°C at 760 mmHg |
Σημείο ανάφλεξης |
134.6°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|