نام محصول |
4-Fluorobenzyl mercaptan |
مترادف |
4-Fluoro-alpha-toluenethiol; 4-Fluoro benzyl mercaptan; p-Fluorotoluene-alpha-thiol; Benzenemethanethiol, 4-fluoro-; p-fluorotoluene-α-thiol; (4-fluorophenyl)methanethiol; 6-fluoro-2-methylquinolin-4(1H)-one |
میدان مغناطیسی |
C10H8FNO |
وزن مولکولی |
177.175 |
InChI |
InChI=1/C10H8FNO/c1-6-4-10(13)8-5-7(11)2-3-9(8)12-6/h2-5H,1H3,(H,12,13) |
شماره سیایاس |
15894-04-9 |
تعداد کمیسیون اروپایی |
240-031-9 |
ساختار مولکولی |
|
تراکم |
1.228g/cm3 |
نقطه غلیان |
275.7°C at 760 mmHg |
ضریب شکست |
1.553 |
نقطه اشتعال |
120.5°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|