Nama produk |
4-Fluorochalcone |
Sinonim |
1-Phenyl-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylideneacetophenone; 3-(4-fluorophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-fluorophenyl)-1-phenylprop-2-en-1-one |
MF |
C15H11FO |
Berat Molekul |
226.2456 |
InChI |
InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
CAS NO |
1608-51-1 |
Struktur Molekul |
|
Kepadatan |
1.166g/cm3 |
Titik lebur |
84℃ |
Titik didih |
345.9°C at 760 mmHg |
Indeks bias |
1.608 |
Titik nyala |
157.3°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|