상품명칭 |
cis-3-Chloroacrylic acid |
별명 |
(Z)-3-Chloroacrylic acid; CCRIS 3547; NSC 202397; cis-beta-Chloroacrylic acid; 2-Propenoic acid, 3-chloro-, (2Z)-; 2-Propenoic acid, 3-chloro-, (Z)- (9CI); Acrylic acid, 3-chloro-, (Z)- (8CI); cis-3-Chloropropenoic acid; (2E)-3-chloroprop-2-enoic acid; (2Z)-3-chloroprop-2-enoic acid; (2Z)-3-chloroprop-2-enoate |
분자식 |
C3H2ClO2 |
분자량 |
105.5003 |
InChI |
InChI=1/C3H3ClO2/c4-2-1-3(5)6/h1-2H,(H,5,6)/p-1/b2-1- |
cas번호 |
1609-93-4 |
EC번호 |
216-545-4 |
분자 구조 |
|
녹는 점 |
60-64℃ |
비등점 |
192.3°C at 760 mmHg |
인화점 |
70.1°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|