상품명칭 |
3-Aminocoumarin |
별명 |
3-Coumarinamine; 3-amino-2H-chromen-2-one |
분자식 |
C9H7NO2 |
분자량 |
161.1574 |
InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
cas번호 |
1635-31-0 |
EC번호 |
216-659-4 |
분자 구조 |
|
밀도 |
1.313g/cm3 |
비등점 |
355.2°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
199.3°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|