اسم المنتج |
3-Amino-6-chloro-2-picoline |
الاسم المستعار |
2-Chloro-5-Amino-6-Methylpyridine; 6-Chloro-2-Methylpyridin-3-Amine; 5-Amino-2-chloro-6-methylpyridine; 3-Amino-6-Chloro-2-Methylpyridine |
الصيغة الجزيئية |
C6H7ClN2 |
الوزن الجزيئي الغرامي |
142.5862 |
InChI |
InChI=1/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3 |
إستراتيجية المساعدة القطرية |
164666-68-6 |
بنية جزيئية |
|
كثافة |
1.26g/cm3 |
نقطة الغليان |
286°C at 760 mmHg |
معامل الإنكسار |
1.592 |
نقطة الوميض |
126.7°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|