produktnavn |
Undecyl methacrylate |
Synonymer |
2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
Molekylær Formel |
C15H28O2 |
Molekylvekt |
240.3816 |
InChI |
InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
CAS-nummer |
16493-35-9 |
EINECS |
240-558-4 |
Molecular Structure |
|
Tetthet |
0.875g/cm3 |
Kokepunkt |
305.9°C at 760 mmHg |
Brytningsindeks |
1.443 |
Flammepunktet |
124.4°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|