Produkt-Name |
4-Chloro-3-nitro-2-pyridone |
Synonyme |
4-Chloro-2-hydroxy-3-nitropyridine; 4-chloro-3-nitropyridin-2(1H)-one; 4-Chloro-3-Nitropyridin-2-Ol |
Molekulare Formel |
C5H3ClN2O3 |
Molecular Weight |
174.5419 |
InChI |
InChI=1/C5H3ClN2O3/c6-3-1-2-7-5(9)4(3)8(10)11/h1-2H,(H,7,9) |
CAS Registry Number |
165547-79-5 |
Molecular Structure |
|
Dichte |
1.61g/cm3 |
Siedepunkt |
283.4°C at 760 mmHg |
Brechungsindex |
1.602 |
Flammpunkt |
125.2°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|