produktnavn |
Bis(2-diphenylphosphinophenyl)ether |
Synonymer |
Bisdiphenylphosphinophenylether; (Oxydi-2,1-phenylene)-bis-(diphenylphosphine); (oxydi-2,1-phenylene)bis(diphenylphosphine); [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenyl-phosphane; DPEPhos |
Molekylær Formel |
C36H28OP2 |
Molekylvekt |
538.5544 |
InChI |
InChI=1/C36H28OP2/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H |
CAS-nummer |
166330-10-5 |
Molecular Structure |
|
Smeltepunkt |
184-187℃ |
Kokepunkt |
608.19°C at 760 mmHg |
Flammepunktet |
404.905°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|