Nome do produto |
2-(Phenylthio)thiophene |
Sinônimos |
Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
Fórmula molecular |
C10H8S2 |
Peso Molecular |
192.3005 |
InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
CAS Registry Number |
16718-12-0 |
Estrutura Molecular |
|
Densidade |
1.24g/cm3 |
Ponto de ebulição |
304.7°C at 760 mmHg |
índice de refração |
1.667 |
O ponto de inflamação |
138.1°C |
Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|