Produkt-Name |
3-Acetoxy-2-Methylbenzoyl Chloride |
Synonyme |
3-Acetoxy-o-toluoyl chloride; 2-methyl-3-acetoxybenzoic chloride; 3-acetoxy-2-methylbenzoic chloride; 3-(chlorocarbonyl)-2-methylphenyl acetate; 2-methyl-3-acetoxy benzoic chloride |
Molekulare Formel |
C10H9ClO3 |
Molecular Weight |
212.6297 |
InChI |
InChI=1/C10H9ClO3/c1-6-8(10(11)13)4-3-5-9(6)14-7(2)12/h3-5H,1-2H3 |
CAS Registry Number |
167678-46-8 |
EINECS |
433-690-0 |
Molecular Structure |
|
Dichte |
1.252g/cm3 |
Siedepunkt |
295.6°C at 760 mmHg |
Brechungsindex |
1.532 |
Flammpunkt |
123.6°C |
Risk Codes |
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|