نام محصول |
2-Hydroxy-3-methoxy-5-nitrobenzaldehyde |
مترادف |
3-Methoxy-5-nitrosalicylaldehyde; 2-formyl-6-methoxy-4-nitrophenolate |
میدان مغناطیسی |
C8H6NO5 |
وزن مولکولی |
196.1375 |
InChI |
InChI=1/C8H7NO5/c1-14-7-3-6(9(12)13)2-5(4-10)8(7)11/h2-4,11H,1H3/p-1 |
شماره سیایاس |
17028-61-4 |
ساختار مولکولی |
|
نقطه ذوب |
140-142℃ |
نقطه غلیان |
344°C at 760 mmHg |
نقطه اشتعال |
161.8°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|