שם המוצר |
Ethyl 3-isothiocyanatopropionate |
נרדפות |
3-Isothiocyanatopropionic acid ethyl ester; ethyl N-(thioxomethylidene)-beta-alaninate |
מולקולרית פורמולה |
C6H9NO2S |
משקל מולקולרי |
159.2062 |
InChI |
InChI=1/C6H9NO2S/c1-2-9-6(8)3-4-7-5-10/h2-4H2,1H3 |
מספר CAS |
17126-62-4 |
מבנה מולקולרי |
|
צפיפות |
1.09g/cm3 |
נקודת רתיחה |
242.9°C at 760 mmHg |
משקל סגולי |
1.498 |
נקודת הבזק |
100.7°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|