product Name |
2-Chloroanthracene |
Synonyms |
Anthracene, 2-chloro-; 4-05-00-02292 (Beilstein Handbook Reference); AI3-23450; BRN 2047055; CCRIS 5549; NSC 408454 |
Molecular Formula |
C14H9Cl |
Molecular Weight |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
CAS Registry Number |
17135-78-3 |
Molecular Structure |
|
Density |
1.253g/cm3 |
Melting point |
221-223℃ |
Boiling point |
370.1°C at 760 mmHg |
Refractive index |
1.717 |
Flash point |
179.2°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|