نام محصول |
3,5-Dimethoxybenzoyl chloride |
میدان مغناطیسی |
C9H9ClO3 |
وزن مولکولی |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
شماره سیایاس |
17213-57-9 |
تعداد کمیسیون اروپایی |
241-256-5 |
ساختار مولکولی |
|
تراکم |
1.224g/cm3 |
نقطه ذوب |
41-47℃ |
نقطه غلیان |
284.5°C at 760 mmHg |
ضریب شکست |
1.52 |
نقطه اشتعال |
131.1°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|