نام محصول |
2,3-Dichlorothiophene |
مترادف |
2,3-dichloro-thiophene |
میدان مغناطیسی |
C4H2Cl2S |
وزن مولکولی |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
شماره سیایاس |
17249-79-5;17249-29-5 |
ساختار مولکولی |
|
تراکم |
1.488g/cm3 |
نقطه ذوب |
-26℃ |
نقطه غلیان |
170.7°C at 760 mmHg |
ضریب شکست |
1.584 |
نقطه اشتعال |
68.9°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|