Naam product |
(2R,5R)-(-)-2,5-Hexanediol |
Synoniemen |
(2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
MF |
C6H14O2 |
Molecuulgewicht |
118.1742 |
InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
CAS-nummer |
17299-07-9 |
Moleculaire Structuur |
|
Dichtheid |
0.958g/cm3 |
Smeltpunt |
50-53℃ |
Kookpunt |
213.4°C at 760 mmHg |
Brekingsindex |
1.445 |
Vlampunt |
101.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|