Produkt-Name |
5-Amino-3-phenyl-1,2,4-thiadiazole |
Synonyme |
3-phenyl-1,2,4-thiadiazol-5-ylamine; 3-methylhex-2-ene; 3-phenyl-1,2,4-thiadiazol-5-amine |
Molekulare Formel |
C8H7N3S |
Molecular Weight |
177.2263 |
InChI |
InChI=1/C8H7N3S/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
CAS Registry Number |
17467-15-1 |
EINECS |
241-485-0 |
Molecular Structure |
|
Dichte |
1.333g/cm3 |
Schmelzpunkt |
152-156℃ |
Siedepunkt |
359°C at 760 mmHg |
Brechungsindex |
1.669 |
Flammpunkt |
170.9°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|