نام محصول |
2-(4-Chlorophenyl)ethyl isothiocyanate |
مترادف |
2-(4-Chlorophenethyl) isothiocyanate; 1-chloro-4-(2-isothiocyanatoethyl)benzene |
میدان مغناطیسی |
C9H8ClNS |
وزن مولکولی |
197.6845 |
InChI |
InChI=1/C9H8ClNS/c10-9-3-1-8(2-4-9)5-6-11-7-12/h1-4H,5-6H2 |
شماره سیایاس |
17608-10-5 |
ساختار مولکولی |
|
تراکم |
1.15g/cm3 |
نقطه غلیان |
311°C at 760 mmHg |
ضریب شکست |
1.572 |
نقطه اشتعال |
141.9°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|